C18H16Br6 — CID 22056706
(1,2,3,4,5,6-hexabromo-1-phenylhexan-2-yl)benzene (PubChem CID 22056706) has the molecular formula C18H16Br6 and a molecular weight of 711.75 g/mol. Its IUPAC name is (1,2,3,4,5,6-hexabromo-1-phenylhexan-2-yl)benzene.
| Compound Name | (1,2,3,4,5,6-hexabromo-1-phenylhexan-2-yl)benzene |
|---|---|
| PubChem CID | 22056706 |
| Molecular Formula | C18H16Br6 |
| Molecular Weight | 711.75 g/mol |
| Exact Mass | 705.64 |
| IUPAC Name | (1,2,3,4,5,6-hexabromo-1-phenylhexan-2-yl)benzene |
| SMILES | BrCC(Br)C(Br)C(Br)C(Br)(c1ccccc1)C(Br)c1ccccc1 |
| InChI | InChI=1S/C18H16Br6/c19-11-14(20)15(21)17(23)18(24,13-9-5-2-6-10-13)16(22)12-7-3-1-4-8-12/h1-10,14-17H,11H2 |
| InChIKey | OTYZGPFLQUOMLP-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.75 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|