C15H12F2N4O3S — CID 2206096
1-(2,4-difluorophenyl)-3-[[2-(4-nitrophenyl)acetyl]amino]thiourea (PubChem CID 2206096) has the molecular formula C15H12F2N4O3S and a molecular weight of 366.35 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[[2-(4-nitrophenyl)acetyl]amino]thiourea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[[2-(4-nitrophenyl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 2206096 |
| Molecular Formula | C15H12F2N4O3S |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[[2-(4-nitrophenyl)acetyl]amino]thiourea |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)NNC(=S)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C15H12F2N4O3S/c16-10-3-6-13(12(17)8-10)18-15(25)20-19-14(22)7-9-1-4-11(5-2-9)21(23)24/h1-6,8H,7H2,(H,19,22)(H2,18,20,25) |
| InChIKey | RFKJZURRDAUIGG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|