C24H27N3O7 — CID 22071928
1-[4-oxo-4-(phenylmethoxyamino)butanoyl]-2-phenylmethoxycarbonylpiperazine-2-carboxylic acid (PubChem CID 22071928) has the molecular formula C24H27N3O7 and a molecular weight of 469.49 g/mol. Its IUPAC name is 1-[4-oxo-4-(phenylmethoxyamino)butanoyl]-2-phenylmethoxycarbonylpiperazine-2-carboxylic acid.
| Compound Name | 1-[4-oxo-4-(phenylmethoxyamino)butanoyl]-2-phenylmethoxycarbonylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 22071928 |
| Molecular Formula | C24H27N3O7 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 1-[4-oxo-4-(phenylmethoxyamino)butanoyl]-2-phenylmethoxycarbonylpiperazine-2-carboxylic acid |
| SMILES | O=C(CCC(=O)N1CCNCC1(C(=O)O)C(=O)OCc1ccccc1)NOCc1ccccc1 |
| InChI | InChI=1S/C24H27N3O7/c28-20(26-34-16-19-9-5-2-6-10-19)11-12-21(29)27-14-13-25-17-24(27,22(30)31)23(32)33-15-18-7-3-1-4-8-18/h1-10,25H,11-17H2,(H,26,28)(H,30,31) |
| InChIKey | IKPYKCSALLWITL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|