C28H36N3O7+ — CID 57132458
1-O-benzyl 1-O'-tert-butyl 4-[4-oxo-4-(phenylmethoxyamino)butanoyl]piperazin-1-ium-1,1-dicarboxylate (PubChem CID 57132458) has the molecular formula C28H36N3O7+ and a molecular weight of 526.61 g/mol. Its IUPAC name is 1-O-benzyl 1-O'-tert-butyl 4-[4-oxo-4-(phenylmethoxyamino)butanoyl]piperazin-1-ium-1,1-dicarboxylate.
| Compound Name | 1-O-benzyl 1-O'-tert-butyl 4-[4-oxo-4-(phenylmethoxyamino)butanoyl]piperazin-1-ium-1,1-dicarboxylate |
|---|---|
| PubChem CID | 57132458 |
| Molecular Formula | C28H36N3O7+ |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | 1-O-benzyl 1-O'-tert-butyl 4-[4-oxo-4-(phenylmethoxyamino)butanoyl]piperazin-1-ium-1,1-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[N+]1(C(=O)OCc2ccccc2)CCN(C(=O)CCC(=O)NOCc2ccccc2)CC1 |
| InChI | InChI=1S/C28H35N3O7/c1-28(2,3)38-27(35)31(26(34)36-20-22-10-6-4-7-11-22)18-16-30(17-19-31)25(33)15-14-24(32)29-37-21-23-12-8-5-9-13-23/h4-13H,14-21H2,1-3H3/p+1 |
| InChIKey | UFSZEKQVVCKZQK-UHFFFAOYSA-O |
| XLogP | 3.95 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|