C29H40N4O4 — CID 57439169
8-[4-[2-[4-(dimethylamino)phenyl]acetyl]piperazin-1-yl]-8-oxo-N-phenylmethoxyoctanamide (PubChem CID 57439169) has the molecular formula C29H40N4O4 and a molecular weight of 508.66 g/mol. Its IUPAC name is 8-[4-[2-[4-(dimethylamino)phenyl]acetyl]piperazin-1-yl]-8-oxo-N-phenylmethoxyoctanamide.
| Compound Name | 8-[4-[2-[4-(dimethylamino)phenyl]acetyl]piperazin-1-yl]-8-oxo-N-phenylmethoxyoctanamide |
|---|---|
| PubChem CID | 57439169 |
| Molecular Formula | C29H40N4O4 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 8-[4-[2-[4-(dimethylamino)phenyl]acetyl]piperazin-1-yl]-8-oxo-N-phenylmethoxyoctanamide |
| SMILES | CN(C)c1ccc(CC(=O)N2CCN(C(=O)CCCCCCC(=O)NOCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H40N4O4/c1-31(2)26-16-14-24(15-17-26)22-29(36)33-20-18-32(19-21-33)28(35)13-9-4-3-8-12-27(34)30-37-23-25-10-6-5-7-11-25/h5-7,10-11,14-17H,3-4,8-9,12-13,18-23H2,1-2H3,(H,30,34) |
| InChIKey | HHEVXIHXRSWMJE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|