C26H35N3O3 — CID 57439173
7-[4-(3,4-dimethylphenyl)piperazin-1-yl]-7-oxo-N-phenylmethoxyheptanamide (PubChem CID 57439173) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 7-[4-(3,4-dimethylphenyl)piperazin-1-yl]-7-oxo-N-phenylmethoxyheptanamide.
| Compound Name | 7-[4-(3,4-dimethylphenyl)piperazin-1-yl]-7-oxo-N-phenylmethoxyheptanamide |
|---|---|
| PubChem CID | 57439173 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 7-[4-(3,4-dimethylphenyl)piperazin-1-yl]-7-oxo-N-phenylmethoxyheptanamide |
| SMILES | Cc1ccc(N2CCN(C(=O)CCCCCC(=O)NOCc3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C26H35N3O3/c1-21-13-14-24(19-22(21)2)28-15-17-29(18-16-28)26(31)12-8-4-7-11-25(30)27-32-20-23-9-5-3-6-10-23/h3,5-6,9-10,13-14,19H,4,7-8,11-12,15-18,20H2,1-2H3,(H,27,30) |
| InChIKey | PAXAWEQEDZKPEA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|