C22H36N4O3 — CID 10216223
8-[4-[2-[4-(dimethylamino)phenyl]ethyl]piperazin-1-yl]-N-hydroxy-8-oxooctanamide (PubChem CID 10216223) has the molecular formula C22H36N4O3 and a molecular weight of 404.56 g/mol. Its IUPAC name is 8-[4-[2-[4-(dimethylamino)phenyl]ethyl]piperazin-1-yl]-N-hydroxy-8-oxooctanamide.
| Compound Name | 8-[4-[2-[4-(dimethylamino)phenyl]ethyl]piperazin-1-yl]-N-hydroxy-8-oxooctanamide |
|---|---|
| PubChem CID | 10216223 |
| Molecular Formula | C22H36N4O3 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 8-[4-[2-[4-(dimethylamino)phenyl]ethyl]piperazin-1-yl]-N-hydroxy-8-oxooctanamide |
| SMILES | CN(C)c1ccc(CCN2CCN(C(=O)CCCCCCC(=O)NO)CC2)cc1 |
| InChI | InChI=1S/C22H36N4O3/c1-24(2)20-11-9-19(10-12-20)13-14-25-15-17-26(18-16-25)22(28)8-6-4-3-5-7-21(27)23-29/h9-12,29H,3-8,13-18H2,1-2H3,(H,23,27) |
| InChIKey | NHOAHXYNKPBSSD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|