C36H34O7 — CID 22075885
6-(oxan-2-yloxy)hexyl 4-(5,12-dioxotetracen-1-yl)oxybenzoate (PubChem CID 22075885) has the molecular formula C36H34O7 and a molecular weight of 578.66 g/mol. Its IUPAC name is 6-(oxan-2-yloxy)hexyl 4-(5,12-dioxotetracen-1-yl)oxybenzoate.
| Compound Name | 6-(oxan-2-yloxy)hexyl 4-(5,12-dioxotetracen-1-yl)oxybenzoate |
|---|---|
| PubChem CID | 22075885 |
| Molecular Formula | C36H34O7 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 6-(oxan-2-yloxy)hexyl 4-(5,12-dioxotetracen-1-yl)oxybenzoate |
| SMILES | O=C(OCCCCCCOC1CCCCO1)c1ccc(Oc2cccc3c2C(=O)c2cc4ccccc4cc2C3=O)cc1 |
| InChI | InChI=1S/C36H34O7/c37-34-28-12-9-13-31(33(28)35(38)30-23-26-11-4-3-10-25(26)22-29(30)34)43-27-17-15-24(16-18-27)36(39)42-21-7-2-1-6-19-40-32-14-5-8-20-41-32/h3-4,9-13,15-18,22-23,32H,1-2,5-8,14,19-21H2 |
| InChIKey | DHJAAJWAKGAFEO-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|