C21H33N5O4 — CID 22077546
5-[7-methyl-2,6-dioxo-8-(2-piperidin-4-ylethyl)-3-propan-2-ylpurin-1-yl]pentanoic acid (PubChem CID 22077546) has the molecular formula C21H33N5O4 and a molecular weight of 419.53 g/mol. Its IUPAC name is 5-[7-methyl-2,6-dioxo-8-(2-piperidin-4-ylethyl)-3-propan-2-ylpurin-1-yl]pentanoic acid.
| Compound Name | 5-[7-methyl-2,6-dioxo-8-(2-piperidin-4-ylethyl)-3-propan-2-ylpurin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 22077546 |
| Molecular Formula | C21H33N5O4 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 5-[7-methyl-2,6-dioxo-8-(2-piperidin-4-ylethyl)-3-propan-2-ylpurin-1-yl]pentanoic acid |
| SMILES | CC(C)n1c(=O)n(CCCCC(=O)O)c(=O)c2c1nc(CCC1CCNCC1)n2C |
| InChI | InChI=1S/C21H33N5O4/c1-14(2)26-19-18(20(29)25(21(26)30)13-5-4-6-17(27)28)24(3)16(23-19)8-7-15-9-11-22-12-10-15/h14-15,22H,4-13H2,1-3H3,(H,27,28) |
| InChIKey | MZPXYMLFXTUJQW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|