C20H14F8O — CID 22080321
2-fluoro-1-[2-[3-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]ethynyl]-4-propylbenzene (PubChem CID 22080321) has the molecular formula C20H14F8O and a molecular weight of 422.32 g/mol. Its IUPAC name is 2-fluoro-1-[2-[3-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]ethynyl]-4-propylbenzene.
| Compound Name | 2-fluoro-1-[2-[3-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]ethynyl]-4-propylbenzene |
|---|---|
| PubChem CID | 22080321 |
| Molecular Formula | C20H14F8O |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 2-fluoro-1-[2-[3-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]ethynyl]-4-propylbenzene |
| SMILES | CCCc1ccc(C#Cc2ccc(OC(F)(F)C(F)C(F)(F)F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C20H14F8O/c1-2-3-12-4-7-14(15(21)10-12)8-5-13-6-9-17(16(22)11-13)29-20(27,28)18(23)19(24,25)26/h4,6-7,9-11,18H,2-3H2,1H3 |
| InChIKey | MDPRBBVTSUGEIK-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|