C30H35ClN2O6 — CID 22086813
tert-butyl N-[1-[N-(2-chloroacetyl)-2-(2-phenylmethoxyphenoxy)anilino]-4-hydroxybutan-2-yl]carbamate (PubChem CID 22086813) has the molecular formula C30H35ClN2O6 and a molecular weight of 555.07 g/mol. Its IUPAC name is tert-butyl N-[1-[N-(2-chloroacetyl)-2-(2-phenylmethoxyphenoxy)anilino]-4-hydroxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-(2-chloroacetyl)-2-(2-phenylmethoxyphenoxy)anilino]-4-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 22086813 |
| Molecular Formula | C30H35ClN2O6 |
| Molecular Weight | 555.07 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | tert-butyl N-[1-[N-(2-chloroacetyl)-2-(2-phenylmethoxyphenoxy)anilino]-4-hydroxybutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCO)CN(C(=O)CCl)c1ccccc1Oc1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C30H35ClN2O6/c1-30(2,3)39-29(36)32-23(17-18-34)20-33(28(35)19-31)24-13-7-8-14-25(24)38-27-16-10-9-15-26(27)37-21-22-11-5-4-6-12-22/h4-16,23,34H,17-21H2,1-3H3,(H,32,36) |
| InChIKey | QBKVPNZDZFGBSR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.07 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|