C19H18N2O5S — CID 22087407
[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl] (1E)-N-sulfanylperoxymethanimidate (PubChem CID 22087407) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is [4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl] (1E)-N-sulfanylperoxymethanimidate.
| Compound Name | [4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl] (1E)-N-sulfanylperoxymethanimidate |
|---|---|
| PubChem CID | 22087407 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | [4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl] (1E)-N-sulfanylperoxymethanimidate |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1ccc(O/C=N/OOS)cc1 |
| InChI | InChI=1S/C19H18N2O5S/c1-14-18(21-19(24-14)15-5-3-2-4-6-15)11-12-22-16-7-9-17(10-8-16)23-13-20-25-26-27/h2-10,13,27H,11-12H2,1H3/b20-13+ |
| InChIKey | WQTSPDWXJCNJPO-DEDYPNTBSA-N |
| XLogP | 4.39 |
| TPSA | 75.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|