C16H33N3O8 — CID 22091063
(3R,4S,5R,6R)-2-[2-(2-aminoethylamino)ethyl-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]amino]-6-methyloxane-3,4,5-triol (PubChem CID 22091063) has the molecular formula C16H33N3O8 and a molecular weight of 395.45 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-[2-(2-aminoethylamino)ethyl-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]amino]-6-methyloxane-3,4,5-triol.
| Compound Name | (3R,4S,5R,6R)-2-[2-(2-aminoethylamino)ethyl-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]amino]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 22091063 |
| Molecular Formula | C16H33N3O8 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | (3R,4S,5R,6R)-2-[2-(2-aminoethylamino)ethyl-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]amino]-6-methyloxane-3,4,5-triol |
| SMILES | C[C@H]1OC(N(CCNCCN)C2O[C@H](C)[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H33N3O8/c1-7-9(20)11(22)13(24)15(26-7)19(6-5-18-4-3-17)16-14(25)12(23)10(21)8(2)27-16/h7-16,18,20-25H,3-6,17H2,1-2H3/t7-,8-,9+,10+,11+,12+,13-,14-,15?,16?/m1/s1 |
| InChIKey | LIOWUJXJUUDBFZ-PHNCZTKASA-N |
| XLogP | -4.51 |
| TPSA | 181.13 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | -4.51 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|