C8H18N2O4 — CID 18641174
(2S,3R,4S,5S,6R)-2-(2-aminoethylamino)-6-methyloxane-3,4,5-triol (PubChem CID 18641174) has the molecular formula C8H18N2O4 and a molecular weight of 206.24 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-(2-aminoethylamino)-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-(2-aminoethylamino)-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 18641174 |
| Molecular Formula | C8H18N2O4 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-(2-aminoethylamino)-6-methyloxane-3,4,5-triol |
| SMILES | C[C@H]1O[C@H](NCCN)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H18N2O4/c1-4-5(11)6(12)7(13)8(14-4)10-3-2-9/h4-8,10-13H,2-3,9H2,1H3/t4-,5-,6+,7-,8+/m1/s1 |
| InChIKey | USQKXBDJRRFWOJ-CBQIKETKSA-N |
| XLogP | -2.64 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |