C14H11BrF2N2O2 — CID 2209375
1-(2-bromo-4,6-difluorophenyl)-3-(4-methoxyphenyl)urea (PubChem CID 2209375) has the molecular formula C14H11BrF2N2O2 and a molecular weight of 357.15 g/mol. Its IUPAC name is 1-(2-bromo-4,6-difluorophenyl)-3-(4-methoxyphenyl)urea.
| Compound Name | 1-(2-bromo-4,6-difluorophenyl)-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 2209375 |
| Molecular Formula | C14H11BrF2N2O2 |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 1-(2-bromo-4,6-difluorophenyl)-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2c(F)cc(F)cc2Br)cc1 |
| InChI | InChI=1S/C14H11BrF2N2O2/c1-21-10-4-2-9(3-5-10)18-14(20)19-13-11(15)6-8(16)7-12(13)17/h2-7H,1H3,(H2,18,19,20) |
| InChIKey | YNPGQDQAKMJVSC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |