C19H24N2O6S — CID 22095370
1,3-bis[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]-1,3-dimethylthiourea (PubChem CID 22095370) has the molecular formula C19H24N2O6S and a molecular weight of 408.48 g/mol. Its IUPAC name is 1,3-bis[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]-1,3-dimethylthiourea.
| Compound Name | 1,3-bis[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]-1,3-dimethylthiourea |
|---|---|
| PubChem CID | 22095370 |
| Molecular Formula | C19H24N2O6S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1,3-bis[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]-1,3-dimethylthiourea |
| SMILES | CN(C(=S)N(C)c1cc(CO)c(O)c(CO)c1)c1cc(CO)c(O)c(CO)c1 |
| InChI | InChI=1S/C19H24N2O6S/c1-20(15-3-11(7-22)17(26)12(4-15)8-23)19(28)21(2)16-5-13(9-24)18(27)14(6-16)10-25/h3-6,22-27H,7-10H2,1-2H3 |
| InChIKey | QJAZDZFSLNLELU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 127.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|