C12H18N2O3S — CID 22095413
1-[2-[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]ethyl]-3-methylthiourea (PubChem CID 22095413) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 1-[2-[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]ethyl]-3-methylthiourea.
| Compound Name | 1-[2-[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]ethyl]-3-methylthiourea |
|---|---|
| PubChem CID | 22095413 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-[2-[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]ethyl]-3-methylthiourea |
| SMILES | CNC(=S)NCCc1cc(CO)c(O)c(CO)c1 |
| InChI | InChI=1S/C12H18N2O3S/c1-13-12(18)14-3-2-8-4-9(6-15)11(17)10(5-8)7-16/h4-5,15-17H,2-3,6-7H2,1H3,(H2,13,14,18) |
| InChIKey | RTSOPRXWPVDURK-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|