C11H15NO3S — CID 22095489
N-[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]-N-methylethanethioamide (PubChem CID 22095489) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is N-[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]-N-methylethanethioamide.
| Compound Name | N-[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]-N-methylethanethioamide |
|---|---|
| PubChem CID | 22095489 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | N-[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]-N-methylethanethioamide |
| SMILES | CC(=S)N(C)c1cc(CO)c(O)c(CO)c1 |
| InChI | InChI=1S/C11H15NO3S/c1-7(16)12(2)10-3-8(5-13)11(15)9(4-10)6-14/h3-4,13-15H,5-6H2,1-2H3 |
| InChIKey | YECTUFXOHYYVTR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|