C23H27N3O5 — CID 22098522
dimethyl 3-[4-[3-[4-(aminomethyl)phenyl]-2-oxoimidazolidin-1-yl]phenyl]pentanedioate (PubChem CID 22098522) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is dimethyl 3-[4-[3-[4-(aminomethyl)phenyl]-2-oxoimidazolidin-1-yl]phenyl]pentanedioate.
| Compound Name | dimethyl 3-[4-[3-[4-(aminomethyl)phenyl]-2-oxoimidazolidin-1-yl]phenyl]pentanedioate |
|---|---|
| PubChem CID | 22098522 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | dimethyl 3-[4-[3-[4-(aminomethyl)phenyl]-2-oxoimidazolidin-1-yl]phenyl]pentanedioate |
| SMILES | COC(=O)CC(CC(=O)OC)c1ccc(N2CCN(c3ccc(CN)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H27N3O5/c1-30-21(27)13-18(14-22(28)31-2)17-5-9-20(10-6-17)26-12-11-25(23(26)29)19-7-3-16(15-24)4-8-19/h3-10,18H,11-15,24H2,1-2H3 |
| InChIKey | QIBDHIBKCQYWPB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |