C28H38O — CID 22099146
(1E)-1-[2,2,4-trimethyl-3-[(1E,3E,5E,7E,9E)-3,7,12-trimethyltrideca-1,3,5,7,9,11-hexaenyl]cyclohex-3-en-1-ylidene]propan-2-one (PubChem CID 22099146) has the molecular formula C28H38O and a molecular weight of 390.61 g/mol. Its IUPAC name is (1E)-1-[2,2,4-trimethyl-3-[(1E,3E,5E,7E,9E)-3,7,12-trimethyltrideca-1,3,5,7,9,11-hexaenyl]cyclohex-3-en-1-ylidene]propan-2-one.
| Compound Name | (1E)-1-[2,2,4-trimethyl-3-[(1E,3E,5E,7E,9E)-3,7,12-trimethyltrideca-1,3,5,7,9,11-hexaenyl]cyclohex-3-en-1-ylidene]propan-2-one |
|---|---|
| PubChem CID | 22099146 |
| Molecular Formula | C28H38O |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | (1E)-1-[2,2,4-trimethyl-3-[(1E,3E,5E,7E,9E)-3,7,12-trimethyltrideca-1,3,5,7,9,11-hexaenyl]cyclohex-3-en-1-ylidene]propan-2-one |
| SMILES | CC(=O)/C=C1\CCC(C)=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)C)C1(C)C |
| InChI | InChI=1S/C28H38O/c1-21(2)12-9-10-13-22(3)14-11-15-23(4)16-19-27-24(5)17-18-26(20-25(6)29)28(27,7)8/h9-16,19-20H,17-18H2,1-8H3/b10-9+,14-11+,19-16+,22-13+,23-15+,26-20+ |
| InChIKey | HHKNQZSPSKEDIA-BXSRFRDESA-N |
| XLogP | 8.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|