C17H20N4O3 — CID 22101111
ethyl 1-benzyl-3-(prop-2-enylcarbamoylamino)pyrazole-4-carboxylate (PubChem CID 22101111) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is ethyl 1-benzyl-3-(prop-2-enylcarbamoylamino)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-benzyl-3-(prop-2-enylcarbamoylamino)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 22101111 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | ethyl 1-benzyl-3-(prop-2-enylcarbamoylamino)pyrazole-4-carboxylate |
| SMILES | C=CCNC(=O)Nc1nn(Cc2ccccc2)cc1C(=O)OCC |
| InChI | InChI=1S/C17H20N4O3/c1-3-10-18-17(23)19-15-14(16(22)24-4-2)12-21(20-15)11-13-8-6-5-7-9-13/h3,5-9,12H,1,4,10-11H2,2H3,(H2,18,19,20,23) |
| InChIKey | SFZCBMIMYRWBRR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|