C17H30N4O3 — CID 22101197
ethyl 1-butyl-3-(hexylcarbamoylamino)pyrazole-4-carboxylate (PubChem CID 22101197) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is ethyl 1-butyl-3-(hexylcarbamoylamino)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-butyl-3-(hexylcarbamoylamino)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 22101197 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | ethyl 1-butyl-3-(hexylcarbamoylamino)pyrazole-4-carboxylate |
| SMILES | CCCCCCNC(=O)Nc1nn(CCCC)cc1C(=O)OCC |
| InChI | InChI=1S/C17H30N4O3/c1-4-7-9-10-11-18-17(23)19-15-14(16(22)24-6-3)13-21(20-15)12-8-5-2/h13H,4-12H2,1-3H3,(H2,18,19,20,23) |
| InChIKey | NOXXLUIZQAPMGB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|