C21H23N5O3 — CID 166349087
ethyl 1-ethyl-3-[(4-pyridin-4-ylphenyl)methylcarbamoylamino]pyrazole-4-carboxylate (PubChem CID 166349087) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is ethyl 1-ethyl-3-[(4-pyridin-4-ylphenyl)methylcarbamoylamino]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-ethyl-3-[(4-pyridin-4-ylphenyl)methylcarbamoylamino]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 166349087 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | ethyl 1-ethyl-3-[(4-pyridin-4-ylphenyl)methylcarbamoylamino]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(CC)nc1NC(=O)NCc1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/C21H23N5O3/c1-3-26-14-18(20(27)29-4-2)19(25-26)24-21(28)23-13-15-5-7-16(8-6-15)17-9-11-22-12-10-17/h5-12,14H,3-4,13H2,1-2H3,(H2,23,24,25,28) |
| InChIKey | RTGVLQUEBXGAPP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |