C15H24N4O2S — CID 22101177
ethyl 3-(cyclohexylcarbamothioylamino)-1-ethylpyrazole-4-carboxylate (PubChem CID 22101177) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is ethyl 3-(cyclohexylcarbamothioylamino)-1-ethylpyrazole-4-carboxylate.
| Compound Name | ethyl 3-(cyclohexylcarbamothioylamino)-1-ethylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 22101177 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | ethyl 3-(cyclohexylcarbamothioylamino)-1-ethylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(CC)nc1NC(=S)NC1CCCCC1 |
| InChI | InChI=1S/C15H24N4O2S/c1-3-19-10-12(14(20)21-4-2)13(18-19)17-15(22)16-11-8-6-5-7-9-11/h10-11H,3-9H2,1-2H3,(H2,16,17,18,22) |
| InChIKey | ZAXILZHBFNUFDD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|