About [2-[4-(hydroxymethyl)-1,3-thiazolidine-3-carbonyl]phenyl]-phenylmethanone
[2-[4-(hydroxymethyl)-1,3-thiazolidine-3-carbonyl]phenyl]-phenylmethanone (PubChem CID 22104466) has the molecular formula C18H17NO3S
and a molecular weight of 327.41 g/mol. Its IUPAC name is [2-[4-(hydroxymethyl)-1,3-thiazolidine-3-carbonyl]phenyl]-phenylmethanone.
Molecular Properties
| Compound Name | [2-[4-(hydroxymethyl)-1,3-thiazolidine-3-carbonyl]phenyl]-phenylmethanone |
| PubChem CID | 22104466 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | [2-[4-(hydroxymethyl)-1,3-thiazolidine-3-carbonyl]phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccccc1C(=O)N1CSCC1CO |
| InChI | InChI=1S/C18H17NO3S/c20-10-14-11-23-12-19(14)18(22)16-9-5-4-8-15(16)17(21)13-6-2-1-3-7-13/h1-9,14,20H,10-12H2 |
| InChIKey | PLDBVVMZLABRIN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[4-(hydroxymethyl)-1,3-thiazolidine-3-carbonyl]phenyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(hydroxymethyl)-1,3-thiazolidine-3-carbonyl]phenyl]-phenylmethanone?
The IUPAC name of [2-[4-(hydroxymethyl)-1,3-thiazolidine-3-carbonyl]phenyl]-phenylmethanone (CID 22104466) is [2-[4-(hydroxymethyl)-1,3-thiazolidine-3-carbonyl]phenyl]-phenylmethanone.
What is the SMILES notation for [2-[4-(hydroxymethyl)-1,3-thiazolidine-3-carbonyl]phenyl]-phenylmethanone?
The canonical SMILES for [2-[4-(hydroxymethyl)-1,3-thiazolidine-3-carbonyl]phenyl]-phenylmethanone is O=C(c1ccccc1)c1ccccc1C(=O)N1CSCC1CO.
What is the InChIKey of [2-[4-(hydroxymethyl)-1,3-thiazolidine-3-carbonyl]phenyl]-phenylmethanone?
The InChIKey is PLDBVVMZLABRIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO3S/c20-10-14-11-23-12-19(14)18(22)16-9-5-4-8-15(16)17(21)13-6-2-1-3-7-13/h1-9,14,20H,10-12H2.
What are the key properties of [2-[4-(hydroxymethyl)-1,3-thiazolidine-3-carbonyl]phenyl]-phenylmethanone?
[2-[4-(hydroxymethyl)-1,3-thiazolidine-3-carbonyl]phenyl]-phenylmethanone has a molecular weight of 327.41 g/mol, XLogP of 2.42, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(hydroxymethyl)-1,3-thiazolidine-3-carbonyl]phenyl]-phenylmethanone is sourced from PubChem (CID 22104466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).