C25H24N4O4S — CID 22109026
N-(1,3-benzoxazol-2-yl)-N-methyl-3-(4-phenylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 22109026) has the molecular formula C25H24N4O4S and a molecular weight of 476.56 g/mol. Its IUPAC name is N-(1,3-benzoxazol-2-yl)-N-methyl-3-(4-phenylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-(1,3-benzoxazol-2-yl)-N-methyl-3-(4-phenylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 22109026 |
| Molecular Formula | C25H24N4O4S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N-(1,3-benzoxazol-2-yl)-N-methyl-3-(4-phenylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | CN(C(=O)c1cccc(S(=O)(=O)N2CCN(c3ccccc3)CC2)c1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C25H24N4O4S/c1-27(25-26-22-12-5-6-13-23(22)33-25)24(30)19-8-7-11-21(18-19)34(31,32)29-16-14-28(15-17-29)20-9-3-2-4-10-20/h2-13,18H,14-17H2,1H3 |
| InChIKey | BDBYLMFJHCROCB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |