C23H26N2O5S — CID 60574663
N-[1-(1-benzofuran-2-yl)ethyl]-N-ethyl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 60574663) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-N-ethyl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-N-ethyl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 60574663 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-N-ethyl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCN(C(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1)C(C)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H26N2O5S/c1-3-25(17(2)22-16-18-7-4-5-10-21(18)30-22)23(26)19-8-6-9-20(15-19)31(27,28)24-11-13-29-14-12-24/h4-10,15-17H,3,11-14H2,1-2H3 |
| InChIKey | PNQGRAIXEYYKNY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |