C27H32N4O7 — CID 22117124
3-[[2-[(3-acetamidophenyl)methyl-(2-benzamido-3-methylbutanoyl)amino]acetyl]amino]-4-oxobutanoic acid (PubChem CID 22117124) has the molecular formula C27H32N4O7 and a molecular weight of 524.57 g/mol. Its IUPAC name is 3-[[2-[(3-acetamidophenyl)methyl-(2-benzamido-3-methylbutanoyl)amino]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-[(3-acetamidophenyl)methyl-(2-benzamido-3-methylbutanoyl)amino]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22117124 |
| Molecular Formula | C27H32N4O7 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 3-[[2-[(3-acetamidophenyl)methyl-(2-benzamido-3-methylbutanoyl)amino]acetyl]amino]-4-oxobutanoic acid |
| SMILES | CC(=O)Nc1cccc(CN(CC(=O)NC(C=O)CC(=O)O)C(=O)C(NC(=O)c2ccccc2)C(C)C)c1 |
| InChI | InChI=1S/C27H32N4O7/c1-17(2)25(30-26(37)20-9-5-4-6-10-20)27(38)31(15-23(34)29-22(16-32)13-24(35)36)14-19-8-7-11-21(12-19)28-18(3)33/h4-12,16-17,22,25H,13-15H2,1-3H3,(H,28,33)(H,29,34)(H,30,37)(H,35,36) |
| InChIKey | JNMOBTCPYGWAOM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|