C16H16N4O2S3 — CID 2211928
1-[[(2S)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoyl]amino]-3-(furan-2-ylmethyl)thiourea (PubChem CID 2211928) has the molecular formula C16H16N4O2S3 and a molecular weight of 392.53 g/mol. Its IUPAC name is 1-[[(2S)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoyl]amino]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[[(2S)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoyl]amino]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2211928 |
| Molecular Formula | C16H16N4O2S3 |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 1-[[(2S)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoyl]amino]-3-(furan-2-ylmethyl)thiourea |
| SMILES | C[C@H](Sc1nc2ccccc2s1)C(=O)NNC(=S)NCc1ccco1 |
| InChI | InChI=1S/C16H16N4O2S3/c1-10(24-16-18-12-6-2-3-7-13(12)25-16)14(21)19-20-15(23)17-9-11-5-4-8-22-11/h2-8,10H,9H2,1H3,(H,19,21)(H2,17,20,23)/t10-/m0/s1 |
| InChIKey | GDABITAIGSMLGH-JTQLQIEISA-N |
| XLogP | 3.07 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|