C32H38NO2- — CID 22121560
6-(2-cyanophenyl)-1-(4-heptylphenyl)-4-pentylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 22121560) has the molecular formula C32H38NO2- and a molecular weight of 468.66 g/mol. Its IUPAC name is 6-(2-cyanophenyl)-1-(4-heptylphenyl)-4-pentylcyclohexa-2,4-diene-1-carboxylate.
| Compound Name | 6-(2-cyanophenyl)-1-(4-heptylphenyl)-4-pentylcyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 22121560 |
| Molecular Formula | C32H38NO2- |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | 6-(2-cyanophenyl)-1-(4-heptylphenyl)-4-pentylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCCCCCCc1ccc(C2(C(=O)[O-])C=CC(CCCCC)=CC2c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C32H39NO2/c1-3-5-7-8-10-13-25-17-19-28(20-18-25)32(31(34)35)22-21-26(14-9-6-4-2)23-30(32)29-16-12-11-15-27(29)24-33/h11-12,15-23,30H,3-10,13-14H2,1-2H3,(H,34,35)/p-1 |
| InChIKey | GNCMLPLECNDDDV-UHFFFAOYSA-M |
| XLogP | 6.92 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|