C22H19ClN4O3 — CID 22122424
ethyl (E)-4-[[4-(6-chloro-2,3-dihydroindol-1-yl)quinazolin-6-yl]amino]-4-oxobut-2-enoate (PubChem CID 22122424) has the molecular formula C22H19ClN4O3 and a molecular weight of 422.87 g/mol. Its IUPAC name is ethyl (E)-4-[[4-(6-chloro-2,3-dihydroindol-1-yl)quinazolin-6-yl]amino]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[[4-(6-chloro-2,3-dihydroindol-1-yl)quinazolin-6-yl]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 22122424 |
| Molecular Formula | C22H19ClN4O3 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | ethyl (E)-4-[[4-(6-chloro-2,3-dihydroindol-1-yl)quinazolin-6-yl]amino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)Nc1ccc2ncnc(N3CCc4ccc(Cl)cc43)c2c1 |
| InChI | InChI=1S/C22H19ClN4O3/c1-2-30-21(29)8-7-20(28)26-16-5-6-18-17(12-16)22(25-13-24-18)27-10-9-14-3-4-15(23)11-19(14)27/h3-8,11-13H,2,9-10H2,1H3,(H,26,28)/b8-7+ |
| InChIKey | UJBNYQWNECXGGC-BQYQJAHWSA-N |
| XLogP | 4.04 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|