C25H26N4O — CID 22132504
(E)-N-[4-(7-cyano-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-3-(1H-indol-5-yl)prop-2-enamide (PubChem CID 22132504) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is (E)-N-[4-(7-cyano-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-3-(1H-indol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-(7-cyano-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-3-(1H-indol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 22132504 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | (E)-N-[4-(7-cyano-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-3-(1H-indol-5-yl)prop-2-enamide |
| SMILES | N#Cc1ccc2c(c1)CN(CCCCNC(=O)/C=C/c1ccc3[nH]ccc3c1)CC2 |
| InChI | InChI=1S/C25H26N4O/c26-17-20-3-6-21-10-14-29(18-23(21)16-20)13-2-1-11-28-25(30)8-5-19-4-7-24-22(15-19)9-12-27-24/h3-9,12,15-16,27H,1-2,10-11,13-14,18H2,(H,28,30)/b8-5+ |
| InChIKey | HIBBRWOYGCKDSP-VMPITWQZSA-N |
| XLogP | 4.01 |
| TPSA | 71.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|