C25H20FN5O3 — CID 22132686
1-cyano-3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-2-(2-fluorophenyl)guanidine (PubChem CID 22132686) has the molecular formula C25H20FN5O3 and a molecular weight of 457.47 g/mol. Its IUPAC name is 1-cyano-3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-2-(2-fluorophenyl)guanidine.
| Compound Name | 1-cyano-3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-2-(2-fluorophenyl)guanidine |
|---|---|
| PubChem CID | 22132686 |
| Molecular Formula | C25H20FN5O3 |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 1-cyano-3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-2-(2-fluorophenyl)guanidine |
| SMILES | COc1cc2nccc(Oc3ccc(N/C(=N/c4ccccc4F)NC#N)cc3)c2cc1OC |
| InChI | InChI=1S/C25H20FN5O3/c1-32-23-13-18-21(14-24(23)33-2)28-12-11-22(18)34-17-9-7-16(8-10-17)30-25(29-15-27)31-20-6-4-3-5-19(20)26/h3-14H,1-2H3,(H2,29,30,31) |
| InChIKey | DABGLYQHAXSYQS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|