C18H17BrNO4- — CID 2213803
4-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylamino]benzoate (PubChem CID 2213803) has the molecular formula C18H17BrNO4- and a molecular weight of 391.24 g/mol. Its IUPAC name is 4-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylamino]benzoate.
| Compound Name | 4-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylamino]benzoate |
|---|---|
| PubChem CID | 2213803 |
| Molecular Formula | C18H17BrNO4- |
| Molecular Weight | 391.24 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 4-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylamino]benzoate |
| SMILES | C=CCOc1c(Br)cc(CNc2ccc(C(=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C18H18BrNO4/c1-3-8-24-17-15(19)9-12(10-16(17)23-2)11-20-14-6-4-13(5-7-14)18(21)22/h3-7,9-10,20H,1,8,11H2,2H3,(H,21,22)/p-1 |
| InChIKey | ZEFBWXFNXCQMCE-UHFFFAOYSA-M |
| XLogP | 3.00 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|