C9H9N2O3- — CID 22138225
(E)-3-[6-amino-5-(hydroxymethyl)-3-pyridinyl]prop-2-enoate (PubChem CID 22138225) has the molecular formula C9H9N2O3- and a molecular weight of 193.18 g/mol. Its IUPAC name is (E)-3-[6-amino-5-(hydroxymethyl)-3-pyridinyl]prop-2-enoate.
| Compound Name | (E)-3-[6-amino-5-(hydroxymethyl)-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 22138225 |
| Molecular Formula | C9H9N2O3- |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | (E)-3-[6-amino-5-(hydroxymethyl)-3-pyridinyl]prop-2-enoate |
| SMILES | Nc1ncc(/C=C/C(=O)[O-])cc1CO |
| InChI | InChI=1S/C9H10N2O3/c10-9-7(5-12)3-6(4-11-9)1-2-8(13)14/h1-4,12H,5H2,(H2,10,11)(H,13,14)/p-1/b2-1+ |
| InChIKey | FKYOJCCQBUMPAM-OWOJBTEDSA-M |
| XLogP | -1.08 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|