C22H20F3N3O7 — CID 2213953
ethyl (4R,5S)-4-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate (PubChem CID 2213953) has the molecular formula C22H20F3N3O7 and a molecular weight of 495.41 g/mol. Its IUPAC name is ethyl (4R,5S)-4-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate.
| Compound Name | ethyl (4R,5S)-4-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 2213953 |
| Molecular Formula | C22H20F3N3O7 |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | ethyl (4R,5S)-4-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate |
| SMILES | C=C1NC(=O)N[C@@H](c2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(OC)c2)[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C22H20F3N3O7/c1-4-34-20(29)18-11(2)26-21(30)27-19(18)12-5-7-16(17(9-12)33-3)35-15-8-6-13(22(23,24)25)10-14(15)28(31)32/h5-10,18-19H,2,4H2,1,3H3,(H2,26,27,30)/t18-,19+/m1/s1 |
| InChIKey | RYFHGGKAHSUGLD-MOPGFXCFSA-N |
| XLogP | 4.46 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|