About 4-anilino-2-methoxybenzenediazonium;benzyl ethenyl sulfate
4-anilino-2-methoxybenzenediazonium;benzyl ethenyl sulfate (PubChem CID 22141896) has the molecular formula C22H22N3O5S+
and a molecular weight of 440.50 g/mol. Its IUPAC name is 4-anilino-2-methoxybenzenediazonium;benzyl ethenyl sulfate.
Molecular Properties
| Compound Name | 4-anilino-2-methoxybenzenediazonium;benzyl ethenyl sulfate |
| PubChem CID | 22141896 |
| Molecular Formula | C22H22N3O5S+ |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 4-anilino-2-methoxybenzenediazonium;benzyl ethenyl sulfate |
| SMILES | C=COS(=O)(=O)OCc1ccccc1.COc1cc(Nc2ccccc2)ccc1[N+]#N |
| InChI | InChI=1S/C13H12N3O.C9H10O4S/c1-17-13-9-11(7-8-12(13)16-14)15-10-5-3-2-4-6-10;1-2-12-14(10,11)13-8-9-6-4-3-5-7-9/h2-9,15H,1H3;2-7H,1,8H2/q+1; |
| InChIKey | UWNRNSWZMVLDBH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-anilino-2-methoxybenzenediazonium;benzyl ethenyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilino-2-methoxybenzenediazonium;benzyl ethenyl sulfate?
The IUPAC name of 4-anilino-2-methoxybenzenediazonium;benzyl ethenyl sulfate (CID 22141896) is 4-anilino-2-methoxybenzenediazonium;benzyl ethenyl sulfate.
What is the SMILES notation for 4-anilino-2-methoxybenzenediazonium;benzyl ethenyl sulfate?
The canonical SMILES for 4-anilino-2-methoxybenzenediazonium;benzyl ethenyl sulfate is C=COS(=O)(=O)OCc1ccccc1.COc1cc(Nc2ccccc2)ccc1[N+]#N.
What is the InChIKey of 4-anilino-2-methoxybenzenediazonium;benzyl ethenyl sulfate?
The InChIKey is UWNRNSWZMVLDBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N3O.C9H10O4S/c1-17-13-9-11(7-8-12(13)16-14)15-10-5-3-2-4-6-10;1-2-12-14(10,11)13-8-9-6-4-3-5-7-9/h2-9,15H,1H3;2-7H,1,8H2/q+1;.
What are the key properties of 4-anilino-2-methoxybenzenediazonium;benzyl ethenyl sulfate?
4-anilino-2-methoxybenzenediazonium;benzyl ethenyl sulfate has a molecular weight of 440.50 g/mol, XLogP of 5.53, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilino-2-methoxybenzenediazonium;benzyl ethenyl sulfate is sourced from PubChem (CID 22141896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).