C20H24BrIN2O — CID 22152871
N-(4-bromo-2,6-diethylphenyl)-5-ethyl-4-iodo-2,6-dimethylpyridine-3-carboxamide (PubChem CID 22152871) has the molecular formula C20H24BrIN2O and a molecular weight of 515.23 g/mol. Its IUPAC name is N-(4-bromo-2,6-diethylphenyl)-5-ethyl-4-iodo-2,6-dimethylpyridine-3-carboxamide.
| Compound Name | N-(4-bromo-2,6-diethylphenyl)-5-ethyl-4-iodo-2,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 22152871 |
| Molecular Formula | C20H24BrIN2O |
| Molecular Weight | 515.23 g/mol |
| Exact Mass | 514.01 |
| IUPAC Name | N-(4-bromo-2,6-diethylphenyl)-5-ethyl-4-iodo-2,6-dimethylpyridine-3-carboxamide |
| SMILES | CCc1cc(Br)cc(CC)c1NC(=O)c1c(C)nc(C)c(CC)c1I |
| InChI | InChI=1S/C20H24BrIN2O/c1-6-13-9-15(21)10-14(7-2)19(13)24-20(25)17-12(5)23-11(4)16(8-3)18(17)22/h9-10H,6-8H2,1-5H3,(H,24,25) |
| InChIKey | AVKGSWXBBSUJDJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.23 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|