C23H30Br2N2O — CID 22152876
4-bromo-N-(4-bromo-2,6-diethylphenyl)-2,6-dimethyl-5-pentylpyridine-3-carboxamide (PubChem CID 22152876) has the molecular formula C23H30Br2N2O and a molecular weight of 510.31 g/mol. Its IUPAC name is 4-bromo-N-(4-bromo-2,6-diethylphenyl)-2,6-dimethyl-5-pentylpyridine-3-carboxamide.
| Compound Name | 4-bromo-N-(4-bromo-2,6-diethylphenyl)-2,6-dimethyl-5-pentylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 22152876 |
| Molecular Formula | C23H30Br2N2O |
| Molecular Weight | 510.31 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | 4-bromo-N-(4-bromo-2,6-diethylphenyl)-2,6-dimethyl-5-pentylpyridine-3-carboxamide |
| SMILES | CCCCCc1c(C)nc(C)c(C(=O)Nc2c(CC)cc(Br)cc2CC)c1Br |
| InChI | InChI=1S/C23H30Br2N2O/c1-6-9-10-11-19-14(4)26-15(5)20(21(19)25)23(28)27-22-16(7-2)12-18(24)13-17(22)8-3/h12-13H,6-11H2,1-5H3,(H,27,28) |
| InChIKey | CRNCVESMWSOQTI-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.31 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|