About 6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline
6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline (PubChem CID 22158274) has the molecular formula C25H30ClNO2
and a molecular weight of 411.97 g/mol. Its IUPAC name is 6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline |
| PubChem CID | 22158274 |
| Molecular Formula | C25H30ClNO2 |
| Molecular Weight | 411.97 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline |
| SMILES | CCCCOc1cc2c(cc1OCCCC)C(/C=C/c1ccc(Cl)cc1)=NCC2 |
| InChI | InChI=1S/C25H30ClNO2/c1-3-5-15-28-24-17-20-13-14-27-23(12-9-19-7-10-21(26)11-8-19)22(20)18-25(24)29-16-6-4-2/h7-12,17-18H,3-6,13-16H2,1-2H3/b12-9+ |
| InChIKey | DCURXDUKEPYDHY-FMIVXFBMSA-N |
| XLogP | 6.76 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.97 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline?
The IUPAC name of 6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline (CID 22158274) is 6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline.
What is the SMILES notation for 6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline?
The canonical SMILES for 6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline is CCCCOc1cc2c(cc1OCCCC)C(/C=C/c1ccc(Cl)cc1)=NCC2.
What is the InChIKey of 6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline?
The InChIKey is DCURXDUKEPYDHY-FMIVXFBMSA-N. The full InChI is InChI=1S/C25H30ClNO2/c1-3-5-15-28-24-17-20-13-14-27-23(12-9-19-7-10-21(26)11-8-19)22(20)18-25(24)29-16-6-4-2/h7-12,17-18H,3-6,13-16H2,1-2H3/b12-9+.
What are the key properties of 6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline?
6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline has a molecular weight of 411.97 g/mol, XLogP of 6.76, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline is sourced from PubChem (CID 22158274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).