C25H30ClNO2 — CID 22158274
6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline (PubChem CID 22158274) has the molecular formula C25H30ClNO2 and a molecular weight of 411.97 g/mol. Its IUPAC name is 6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline.
| Compound Name | 6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 22158274 |
| Molecular Formula | C25H30ClNO2 |
| Molecular Weight | 411.97 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 6,7-dibutoxy-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline |
| SMILES | CCCCOc1cc2c(cc1OCCCC)C(/C=C/c1ccc(Cl)cc1)=NCC2 |
| InChI | InChI=1S/C25H30ClNO2/c1-3-5-15-28-24-17-20-13-14-27-23(12-9-19-7-10-21(26)11-8-19)22(20)18-25(24)29-16-6-4-2/h7-12,17-18H,3-6,13-16H2,1-2H3/b12-9+ |
| InChIKey | DCURXDUKEPYDHY-FMIVXFBMSA-N |
| XLogP | 6.76 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.97 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|