C8H9N3O — CID 22162321
5,6-diamino-1,3-dihydroindol-2-one (PubChem CID 22162321) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 5,6-diamino-1,3-dihydroindol-2-one.
| Compound Name | 5,6-diamino-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 22162321 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 5,6-diamino-1,3-dihydroindol-2-one |
| SMILES | Nc1cc2c(cc1N)NC(=O)C2 |
| InChI | InChI=1S/C8H9N3O/c9-5-1-4-2-8(12)11-7(4)3-6(5)10/h1,3H,2,9-10H2,(H,11,12) |
| InChIKey | VVEJNQMYFCSJIN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|