About 1-sulfonatooxyethenyl sulfate
1-sulfonatooxyethenyl sulfate (PubChem CID 22162560) has the molecular formula C2H2O8S2-2
and a molecular weight of 218.16 g/mol. Its IUPAC name is 1-sulfonatooxyethenyl sulfate.
Molecular Properties
| Compound Name | 1-sulfonatooxyethenyl sulfate |
| PubChem CID | 22162560 |
| Molecular Formula | C2H2O8S2-2 |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 217.92 |
| IUPAC Name | 1-sulfonatooxyethenyl sulfate |
| SMILES | C=C(OS(=O)(=O)[O-])OS(=O)(=O)[O-] |
| InChI | InChI=1S/C2H4O8S2/c1-2(9-11(3,4)5)10-12(6,7)8/h1H2,(H,3,4,5)(H,6,7,8)/p-2 |
| InChIKey | OJJCDFOFIVGCQK-UHFFFAOYSA-L |
| XLogP | -1.59 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 1-sulfonatooxyethenyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-sulfonatooxyethenyl sulfate?
The IUPAC name of 1-sulfonatooxyethenyl sulfate (CID 22162560) is 1-sulfonatooxyethenyl sulfate.
What is the SMILES notation for 1-sulfonatooxyethenyl sulfate?
The canonical SMILES for 1-sulfonatooxyethenyl sulfate is C=C(OS(=O)(=O)[O-])OS(=O)(=O)[O-].
What is the InChIKey of 1-sulfonatooxyethenyl sulfate?
The InChIKey is OJJCDFOFIVGCQK-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H4O8S2/c1-2(9-11(3,4)5)10-12(6,7)8/h1H2,(H,3,4,5)(H,6,7,8)/p-2.
What are the key properties of 1-sulfonatooxyethenyl sulfate?
1-sulfonatooxyethenyl sulfate has a molecular weight of 218.16 g/mol, XLogP of -1.59, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-sulfonatooxyethenyl sulfate is sourced from PubChem (CID 22162560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).