C30H34FN4O4+ — CID 22162928
2-[3-(N-(5-fluoro-1-propylpyridin-1-ium-3-carbonyl)anilino)propanoylamino]ethyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate (PubChem CID 22162928) has the molecular formula C30H34FN4O4+ and a molecular weight of 533.62 g/mol. Its IUPAC name is 2-[3-(N-(5-fluoro-1-propylpyridin-1-ium-3-carbonyl)anilino)propanoylamino]ethyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate.
| Compound Name | 2-[3-(N-(5-fluoro-1-propylpyridin-1-ium-3-carbonyl)anilino)propanoylamino]ethyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 22162928 |
| Molecular Formula | C30H34FN4O4+ |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 2-[3-(N-(5-fluoro-1-propylpyridin-1-ium-3-carbonyl)anilino)propanoylamino]ethyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate |
| SMILES | CCC[n+]1cc(F)cc(C(=O)N(CCC(=O)NCCOC(=O)C2NCCc3ccccc32)c2ccccc2)c1 |
| InChI | InChI=1S/C30H33FN4O4/c1-2-16-34-20-23(19-24(31)21-34)29(37)35(25-9-4-3-5-10-25)17-13-27(36)32-15-18-39-30(38)28-26-11-7-6-8-22(26)12-14-33-28/h3-11,19-21,28,33H,2,12-18H2,1H3/p+1 |
| InChIKey | ADGMOQWJASPHHQ-UHFFFAOYSA-O |
| XLogP | 3.11 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|