C33H42BrIN4O6 — CID 88602824
2-[3-(N-(5-bromo-1-propylpyridin-1-ium-3-carbonyl)anilino)propanoylamino]ethyl N-[(2,5-dimethoxy-3,4,6-trimethylphenyl)methyl]carbamate iodide (PubChem CID 88602824) has the molecular formula C33H42BrIN4O6 and a molecular weight of 797.53 g/mol. Its IUPAC name is 2-[3-(N-(5-bromo-1-propylpyridin-1-ium-3-carbonyl)anilino)propanoylamino]ethyl N-[(2,5-dimethoxy-3,4,6-trimethylphenyl)methyl]carbamate iodide.
| Compound Name | 2-[3-(N-(5-bromo-1-propylpyridin-1-ium-3-carbonyl)anilino)propanoylamino]ethyl N-[(2,5-dimethoxy-3,4,6-trimethylphenyl)methyl]carbamate iodide |
|---|---|
| PubChem CID | 88602824 |
| Molecular Formula | C33H42BrIN4O6 |
| Molecular Weight | 797.53 g/mol |
| Exact Mass | 796.13 |
| IUPAC Name | 2-[3-(N-(5-bromo-1-propylpyridin-1-ium-3-carbonyl)anilino)propanoylamino]ethyl N-[(2,5-dimethoxy-3,4,6-trimethylphenyl)methyl]carbamate iodide |
| SMILES | CCC[n+]1cc(Br)cc(C(=O)N(CCC(=O)NCCOC(=O)NCc2c(C)c(OC)c(C)c(C)c2OC)c2ccccc2)c1.[I-] |
| InChI | InChI=1S/C33H41BrN4O6.HI/c1-7-15-37-20-25(18-26(34)21-37)32(40)38(27-11-9-8-10-12-27)16-13-29(39)35-14-17-44-33(41)36-19-28-24(4)30(42-5)22(2)23(3)31(28)43-6;/h8-12,18,20-21H,7,13-17,19H2,1-6H3,(H-,35,36,39,41);1H |
| InChIKey | UXTQRJIBBOPFAR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|