About 2-phenoxyethyl N-[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]ethyl]-N-phenylcarbamate iodide
2-phenoxyethyl N-[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]ethyl]-N-phenylcarbamate iodide (PubChem CID 67869419) has the molecular formula C26H29BrIN3O4
and a molecular weight of 654.34 g/mol. Its IUPAC name is 2-phenoxyethyl N-[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]ethyl]-N-phenylcarbamate iodide.
Molecular Properties
| Compound Name | 2-phenoxyethyl N-[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]ethyl]-N-phenylcarbamate iodide |
| PubChem CID | 67869419 |
| Molecular Formula | C26H29BrIN3O4 |
| Molecular Weight | 654.34 g/mol |
| Exact Mass | 653.04 |
| IUPAC Name | 2-phenoxyethyl N-[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]ethyl]-N-phenylcarbamate iodide |
| SMILES | CCC[n+]1cc(Br)cc(C(=O)NCCN(C(=O)OCCOc2ccccc2)c2ccccc2)c1.[I-] |
| InChI | InChI=1S/C26H28BrN3O4.HI/c1-2-14-29-19-21(18-22(27)20-29)25(31)28-13-15-30(23-9-5-3-6-10-23)26(32)34-17-16-33-24-11-7-4-8-12-24;/h3-12,18-20H,2,13-17H2,1H3;1H |
| InChIKey | XDVAOAHSURRVEN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 654.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxyethyl N-[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]ethyl]-N-phenylcarbamate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyethyl N-[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]ethyl]-N-phenylcarbamate iodide?
The IUPAC name of 2-phenoxyethyl N-[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]ethyl]-N-phenylcarbamate iodide (CID 67869419) is 2-phenoxyethyl N-[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]ethyl]-N-phenylcarbamate iodide.
What is the SMILES notation for 2-phenoxyethyl N-[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]ethyl]-N-phenylcarbamate iodide?
The canonical SMILES for 2-phenoxyethyl N-[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]ethyl]-N-phenylcarbamate iodide is CCC[n+]1cc(Br)cc(C(=O)NCCN(C(=O)OCCOc2ccccc2)c2ccccc2)c1.[I-].
What is the InChIKey of 2-phenoxyethyl N-[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]ethyl]-N-phenylcarbamate iodide?
The InChIKey is XDVAOAHSURRVEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28BrN3O4.HI/c1-2-14-29-19-21(18-22(27)20-29)25(31)28-13-15-30(23-9-5-3-6-10-23)26(32)34-17-16-33-24-11-7-4-8-12-24;/h3-12,18-20H,2,13-17H2,1H3;1H.
What are the key properties of 2-phenoxyethyl N-[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]ethyl]-N-phenylcarbamate iodide?
2-phenoxyethyl N-[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]ethyl]-N-phenylcarbamate iodide has a molecular weight of 654.34 g/mol, XLogP of 1.60, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyethyl N-[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]ethyl]-N-phenylcarbamate iodide is sourced from PubChem (CID 67869419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).