C32H35BrClN3O5 — CID 67869448
2-[2-[2-(N-(5-bromo-1-propylpyridin-1-ium-3-carbonyl)anilino)ethoxy]ethoxy]ethyl N-naphthalen-1-ylcarbamate chloride (PubChem CID 67869448) has the molecular formula C32H35BrClN3O5 and a molecular weight of 657.01 g/mol. Its IUPAC name is 2-[2-[2-(N-(5-bromo-1-propylpyridin-1-ium-3-carbonyl)anilino)ethoxy]ethoxy]ethyl N-naphthalen-1-ylcarbamate chloride.
| Compound Name | 2-[2-[2-(N-(5-bromo-1-propylpyridin-1-ium-3-carbonyl)anilino)ethoxy]ethoxy]ethyl N-naphthalen-1-ylcarbamate chloride |
|---|---|
| PubChem CID | 67869448 |
| Molecular Formula | C32H35BrClN3O5 |
| Molecular Weight | 657.01 g/mol |
| Exact Mass | 655.14 |
| IUPAC Name | 2-[2-[2-(N-(5-bromo-1-propylpyridin-1-ium-3-carbonyl)anilino)ethoxy]ethoxy]ethyl N-naphthalen-1-ylcarbamate chloride |
| SMILES | CCC[n+]1cc(Br)cc(C(=O)N(CCOCCOCCOC(=O)Nc2cccc3ccccc23)c2ccccc2)c1.[Cl-] |
| InChI | InChI=1S/C32H34BrN3O5.ClH/c1-2-15-35-23-26(22-27(33)24-35)31(37)36(28-11-4-3-5-12-28)16-17-39-18-19-40-20-21-41-32(38)34-30-14-8-10-25-9-6-7-13-29(25)30;/h3-14,22-24H,2,15-21H2,1H3;1H |
| InChIKey | CDSHZAAFJHSEFY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 80.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.01 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|