C35H34BrIN4O5 — CID 67868628
1-[[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]-1-naphthalen-2-ylethoxy]carbonylamino]ethyl N-naphthalen-1-ylcarbamate iodide (PubChem CID 67868628) has the molecular formula C35H34BrIN4O5 and a molecular weight of 797.49 g/mol. Its IUPAC name is 1-[[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]-1-naphthalen-2-ylethoxy]carbonylamino]ethyl N-naphthalen-1-ylcarbamate iodide.
| Compound Name | 1-[[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]-1-naphthalen-2-ylethoxy]carbonylamino]ethyl N-naphthalen-1-ylcarbamate iodide |
|---|---|
| PubChem CID | 67868628 |
| Molecular Formula | C35H34BrIN4O5 |
| Molecular Weight | 797.49 g/mol |
| Exact Mass | 796.08 |
| IUPAC Name | 1-[[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]-1-naphthalen-2-ylethoxy]carbonylamino]ethyl N-naphthalen-1-ylcarbamate iodide |
| SMILES | CCC[n+]1cc(Br)cc(C(=O)NCC(OC(=O)NC(C)OC(=O)Nc2cccc3ccccc23)c2ccc3ccccc3c2)c1.[I-] |
| InChI | InChI=1S/C35H33BrN4O5.HI/c1-3-17-40-21-28(19-29(36)22-40)33(41)37-20-32(27-16-15-24-9-4-5-11-26(24)18-27)45-34(42)38-23(2)44-35(43)39-31-14-8-12-25-10-6-7-13-30(25)31;/h4-16,18-19,21-23,32H,3,17,20H2,1-2H3,(H2-,37,38,39,41,42,43);1H |
| InChIKey | CMOQJZNBWFSYCK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 109.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|