C31H31BrI2N4O5 — CID 67869553
1-[[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]-1-(4-iodophenyl)ethoxy]carbonylamino]ethyl N-naphthalen-1-ylcarbamate iodide (PubChem CID 67869553) has the molecular formula C31H31BrI2N4O5 and a molecular weight of 873.32 g/mol. Its IUPAC name is 1-[[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]-1-(4-iodophenyl)ethoxy]carbonylamino]ethyl N-naphthalen-1-ylcarbamate iodide.
| Compound Name | 1-[[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]-1-(4-iodophenyl)ethoxy]carbonylamino]ethyl N-naphthalen-1-ylcarbamate iodide |
|---|---|
| PubChem CID | 67869553 |
| Molecular Formula | C31H31BrI2N4O5 |
| Molecular Weight | 873.32 g/mol |
| Exact Mass | 871.96 |
| IUPAC Name | 1-[[2-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]-1-(4-iodophenyl)ethoxy]carbonylamino]ethyl N-naphthalen-1-ylcarbamate iodide |
| SMILES | CCC[n+]1cc(Br)cc(C(=O)NCC(OC(=O)NC(C)OC(=O)Nc2cccc3ccccc23)c2ccc(I)cc2)c1.[I-] |
| InChI | InChI=1S/C31H30BrIN4O5.HI/c1-3-15-37-18-23(16-24(32)19-37)29(38)34-17-28(22-11-13-25(33)14-12-22)42-30(39)35-20(2)41-31(40)36-27-10-6-8-21-7-4-5-9-26(21)27;/h4-14,16,18-20,28H,3,15,17H2,1-2H3,(H2-,34,35,36,38,39,40);1H |
| InChIKey | WFQWUSSXDHEFHT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 109.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|