C34H38BrClN4O8 — CID 15101255
2-[2-(N-(5-bromo-1-propylpyridin-1-ium-3-carbonyl)-3,4,5-trimethoxyanilino)ethoxycarbonylamino]ethyl N-naphthalen-1-ylcarbamate chloride (PubChem CID 15101255) has the molecular formula C34H38BrClN4O8 and a molecular weight of 746.05 g/mol. Its IUPAC name is 2-[2-(N-(5-bromo-1-propylpyridin-1-ium-3-carbonyl)-3,4,5-trimethoxyanilino)ethoxycarbonylamino]ethyl N-naphthalen-1-ylcarbamate chloride.
| Compound Name | 2-[2-(N-(5-bromo-1-propylpyridin-1-ium-3-carbonyl)-3,4,5-trimethoxyanilino)ethoxycarbonylamino]ethyl N-naphthalen-1-ylcarbamate chloride |
|---|---|
| PubChem CID | 15101255 |
| Molecular Formula | C34H38BrClN4O8 |
| Molecular Weight | 746.05 g/mol |
| Exact Mass | 744.16 |
| IUPAC Name | 2-[2-(N-(5-bromo-1-propylpyridin-1-ium-3-carbonyl)-3,4,5-trimethoxyanilino)ethoxycarbonylamino]ethyl N-naphthalen-1-ylcarbamate chloride |
| SMILES | CCC[n+]1cc(Br)cc(C(=O)N(CCOC(=O)NCCOC(=O)Nc2cccc3ccccc23)c2cc(OC)c(OC)c(OC)c2)c1.[Cl-] |
| InChI | InChI=1S/C34H37BrN4O8.ClH/c1-5-14-38-21-24(18-25(35)22-38)32(40)39(26-19-29(43-2)31(45-4)30(20-26)44-3)15-17-47-33(41)36-13-16-46-34(42)37-28-12-8-10-23-9-6-7-11-27(23)28;/h6-12,18-22H,5,13-17H2,1-4H3,(H-,36,37,41,42);1H |
| InChIKey | BZQWOHCACXDDGP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.05 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|