C31H32BrN4O4+ — CID 22162861
2-[3-(N-(5-bromo-1-propylpyridin-1-ium-3-carbonyl)anilino)propanoylamino]ethyl N-naphthalen-1-ylcarbamate (PubChem CID 22162861) has the molecular formula C31H32BrN4O4+ and a molecular weight of 604.53 g/mol. Its IUPAC name is 2-[3-(N-(5-bromo-1-propylpyridin-1-ium-3-carbonyl)anilino)propanoylamino]ethyl N-naphthalen-1-ylcarbamate.
| Compound Name | 2-[3-(N-(5-bromo-1-propylpyridin-1-ium-3-carbonyl)anilino)propanoylamino]ethyl N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 22162861 |
| Molecular Formula | C31H32BrN4O4+ |
| Molecular Weight | 604.53 g/mol |
| Exact Mass | 603.16 |
| IUPAC Name | 2-[3-(N-(5-bromo-1-propylpyridin-1-ium-3-carbonyl)anilino)propanoylamino]ethyl N-naphthalen-1-ylcarbamate |
| SMILES | CCC[n+]1cc(Br)cc(C(=O)N(CCC(=O)NCCOC(=O)Nc2cccc3ccccc23)c2ccccc2)c1 |
| InChI | InChI=1S/C31H31BrN4O4/c1-2-17-35-21-24(20-25(32)22-35)30(38)36(26-11-4-3-5-12-26)18-15-29(37)33-16-19-40-31(39)34-28-14-8-10-23-9-6-7-13-27(23)28/h3-14,20-22H,2,15-19H2,1H3,(H-,33,34,37,39)/p+1 |
| InChIKey | JRELWPJZZUANNE-UHFFFAOYSA-O |
| XLogP | 5.70 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|